CAS 713519-22-3 is the registry number for 9-O-Benzyl-8-O-Methyl-urolithin C. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
3-hydroxy-8-methoxy-9-phenylmethoxybenzo[c]chromen-6-one (CAS 713519-22-3) is a chemical compound with the molecular formula C21H16O5 and a molecular weight of 348.3 g/mol. IUPAC name: 3-hydroxy-8-methoxy-9-phenylmethoxybenzo[c]chromen-6-one. InChIKey: XDXBYZLRJCEUHJ-UHFFFAOYSA-N.
| Molecular formula | C21H16O5 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 3-hydroxy-8-methoxy-9-phenylmethoxybenzo[c]chromen-6-one |
| InChIKey | XDXBYZLRJCEUHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C3=C(C=C(C=C3)O)OC(=O)C2=C1)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)