CAS 664366-12-5 appears in our catalog under these names: (5,9-Dimethyl-7-oxo-3-phenyl-7h-furo[3,2-g]chromen-6-yl)acetic acid, 95%, 2-(5,9-Dimethyl-7-oxo-3-phenyl-7H-furo(3,2-g)chromen-6-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetic acid (CAS 664366-12-5) is a chemical compound with the molecular formula C21H16O5 and a molecular weight of 348.3 g/mol. IUPAC name: 2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetic acid. InChIKey: BXUDTPJQXZXHND-UHFFFAOYSA-N.
| Molecular formula | C21H16O5 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetic acid |
| InChIKey | BXUDTPJQXZXHND-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C(C3=C(C=C12)C(=CO3)C4=CC=CC=C4)C)CC(=O)O |
Computed by PubChem (NCBI)