2,5-Bis(pentyloxy)terephthalaldehyde, 98%
cas: 278186-49-5 — see every product listed under this CAS number, including other names
2,5-Bis(pentyloxy)terephthalaldehyde, 98% (CAS 278186-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1196018-250mg |
| cas | 278186-49-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1955.69 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1149.20 Pln | |
| Fluorochem | 100mg | 492.55 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 2007.64 Pln | |
| BLDpharm | 100mg | 475.41 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 1919.35 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,5-dipentoxyterephthalaldehyde (CAS 278186-49-5) is a chemical compound with the molecular formula C18H26O4 and a molecular weight of 306.4 g/mol. IUPAC name: 2,5-dipentoxyterephthalaldehyde. InChIKey: CDGFWXXDMZDXPL-UHFFFAOYSA-N.
| Molecular formula | C18H26O4 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2,5-dipentoxyterephthalaldehyde |
| InChIKey | CDGFWXXDMZDXPL-UHFFFAOYSA-N |
| SMILES | CCCCCOC1=CC(=C(C=C1C=O)OCCCCC)C=O |
Computed by PubChem (NCBI)