CAS 1346600-89-2 is the registry number for Isopentyl Pentyl Phthalate-d4. Offered by: TRC. Available pack sizes: 10mg.
2-O-(3-methylbutyl) 1-O-pentyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1346600-89-2) is a chemical compound with the molecular formula C18H26O4 and a molecular weight of 310.4 g/mol. IUPAC name: 2-O-(3-methylbutyl) 1-O-pentyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: MCXWUHMDAJQKBI-NECLWFIRSA-N.
| Molecular formula | C18H26O4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-O-(3-methylbutyl) 1-O-pentyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | MCXWUHMDAJQKBI-NECLWFIRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCC)C(=O)OCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)