Products 1346597-80-5
CAS 1346597-80-5 appears in our catalog under these names: Diisopentyl Phthalate-d4, >95% (HPLC), Bis(3-methylbutyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Phthalic acid, bis-isopentyl ester D4, Diisopentyl phthalate-d4. Offered by: TRC, CDN, Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 100 mg, 10 mg.
Bis(3-methylbutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1346597-80-5) is a chemical compound with the molecular formula C18H26O4 and a molecular weight of 310.4 g/mol. IUPAC name: bis(3-methylbutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: JANBFCARANRIKJ-KDWZCNHSSA-N.
| Molecular formula | C18H26O4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | bis(3-methylbutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | JANBFCARANRIKJ-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCC(C)C)C(=O)OCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)