cas: 7139-89-1 — see every product listed under this CAS number, including other names
2,5-Diaminobenzene-1,4-disulfonic acid, 97%, 97% (CAS 7139-89-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IC6Z-250mg |
| cas | 7139-89-1 |
| size | 250mg |
| availability | 525g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 15g | 726.80 Pln | |
| Chemat | 25g | 1048.40 Pln | |
| Chemat | 50g | 1936.40 Pln | |
| Chemat | 75g | 2848.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-diaminobenzene-1,4-disulfonic acid (CAS 7139-89-1) is a chemical compound with the molecular formula C6H8N2O6S2 and a molecular weight of 268.3 g/mol. IUPAC name: 2,5-diaminobenzene-1,4-disulfonic acid. InChIKey: VOPSFYWMOIKYEM-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O6S2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 2,5-diaminobenzene-1,4-disulfonic acid |
| InChIKey | VOPSFYWMOIKYEM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)O)N)S(=O)(=O)O)N |
Computed by PubChem (NCBI)