CAS 137-50-8 appears in our catalog under these names: m-Phenylenediamine-4,6-disulfonic acid, 4,6-Diaminobenzene-1,3-disulfonic acid, 95%, 95%, 4,6-Diaminobenzene-1,3-disulfonic acid, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 500g, 100mg, 250mg, 1g.
4,6-diaminobenzene-1,3-disulfonic acid (CAS 137-50-8) is a chemical compound with the molecular formula C6H8N2O6S2 and a molecular weight of 268.3 g/mol. IUPAC name: 4,6-diaminobenzene-1,3-disulfonic acid. InChIKey: YADSWTKOIHUSDX-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O6S2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4,6-diaminobenzene-1,3-disulfonic acid |
| InChIKey | YADSWTKOIHUSDX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)