CAS 7139-89-1 appears in our catalog under these names: 2,5–Diaminobenzene–1,4–disulfonic acid, p-Phenylenediamine-2,5-disulphonic acid, 2,5-Diaminobenzene-1,4-disulfonic acid, 97%, 97%, 2,5-Diaminobenzene-1,4-disulfonic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 2g, 5g, 10g, 15g.
2,5-diaminobenzene-1,4-disulfonic acid (CAS 7139-89-1) is a chemical compound with the molecular formula C6H8N2O6S2 and a molecular weight of 268.3 g/mol. IUPAC name: 2,5-diaminobenzene-1,4-disulfonic acid. InChIKey: VOPSFYWMOIKYEM-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O6S2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 2,5-diaminobenzene-1,4-disulfonic acid |
| InChIKey | VOPSFYWMOIKYEM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)O)N)S(=O)(=O)O)N |
Computed by PubChem (NCBI)