cas: 610-71-9 — see every product listed under this CAS number, including other names
2,5-Dibromobenzoic acid 98% (CAS 610-71-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A264929-1g |
| cas | 610-71-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 2895.75 Pln | |
| Ambeed | 1000g | 4876.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A264929 |
2,5-dibromobenzoic acid (CAS 610-71-9) is a chemical compound with the molecular formula C7H4Br2O2 and a molecular weight of 279.91 g/mol. IUPAC name: 2,5-dibromobenzoic acid. InChIKey: SQQKOTVDGCJJKI-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2O2 |
|---|---|
| Molecular weight | 279.91 g/mol |
| IUPAC name | 2,5-dibromobenzoic acid |
| InChIKey | SQQKOTVDGCJJKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)