Products 601-84-3
CAS 601-84-3 appears in our catalog under these names: 2,6-Dibromobenzoic acid, 97%, 2,6–Dibromobenzoic Acid, 2,6-Dibromobenzoic acid, 2,6-Dibromobenzoic Acid, >98.0%(GC)(T), 2,6-Dibromobenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 0,025g, 0,05g, 0,1g.
2,6-dibromobenzoic acid (CAS 601-84-3) is a chemical compound with the molecular formula C7H4Br2O2 and a molecular weight of 279.91 g/mol. IUPAC name: 2,6-dibromobenzoic acid. InChIKey: HQLOEBRPCVIFCT-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2O2 |
|---|---|
| Molecular weight | 279.91 g/mol |
| IUPAC name | 2,6-dibromobenzoic acid |
| InChIKey | HQLOEBRPCVIFCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)