CAS 618-58-6 appears in our catalog under these names: 3,5–Dibromobenzoic Acid, 3,5-Dibromobenzoic acid/ 98%, 3,5-Dibromobenzoic Acid, >97.0%(GC)(T), 3,5-Dibromobenzoic acid 97%, 3,5-DIBROMOBENZOIC ACID 95%. Offered by: GLPBio, Chemat, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 1g, 5g, 25g, 1000g, 10g.
3,5-dibromobenzoic acid (CAS 618-58-6) is a chemical compound with the molecular formula C7H4Br2O2 and a molecular weight of 279.91 g/mol. IUPAC name: 3,5-dibromobenzoic acid. InChIKey: SFTFNJZWZHASAQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2O2 |
|---|---|
| Molecular weight | 279.91 g/mol |
| IUPAC name | 3,5-dibromobenzoic acid |
| InChIKey | SFTFNJZWZHASAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)