cas: 943735-44-2 — see every product listed under this CAS number, including other names
2,5-Dibromothiazole-4-carboxylic acid 95% (CAS 943735-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A127304-100mg |
| cas | 943735-44-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 3223.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A127304 |
2,5-dibromo-1,3-thiazole-4-carboxylic acid (CAS 943735-44-2) is a chemical compound with the molecular formula C4HBr2NO2S and a molecular weight of 286.93 g/mol. IUPAC name: 2,5-dibromo-1,3-thiazole-4-carboxylic acid. InChIKey: BJOOXANOAMTJPK-UHFFFAOYSA-N.
| Molecular formula | C4HBr2NO2S |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 2,5-dibromo-1,3-thiazole-4-carboxylic acid |
| InChIKey | BJOOXANOAMTJPK-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)Br)Br)C(=O)O |
Computed by PubChem (NCBI)