Products 943735-44-2

CAS 943735-44-2 appears in our catalog under these names: 2,5-Dibromothiazole-4-carboxylic acid, 95%, 2,5–Dibromothiazole–4–carboxylic acid, dibromo-1,3-thiazole-4-carboxylic acid, 2,5-Dibromothiazole-4-carboxylic acid 95%, 2,5-Dibromothiazole-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

2,5-dibromo-1,3-thiazole-4-carboxylic acid (CAS 943735-44-2) is a chemical compound with the molecular formula C4HBr2NO2S and a molecular weight of 286.93 g/mol. IUPAC name: 2,5-dibromo-1,3-thiazole-4-carboxylic acid. InChIKey: BJOOXANOAMTJPK-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBr2NO2S
Molecular weight286.93 g/mol
IUPAC name2,5-dibromo-1,3-thiazole-4-carboxylic acid
InChIKeyBJOOXANOAMTJPK-UHFFFAOYSA-N
SMILESC1(=C(SC(=N1)Br)Br)C(=O)O

Computed by PubChem (NCBI)