cas: 943735-44-2 — see every product listed under this CAS number, including other names
2,5–Dibromothiazole–4–carboxylic acid (CAS 943735-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF38833-100mg |
| cas | 943735-44-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 854.47 Pln | |
| GLPBio | 1g | 1818.65 Pln | |
| GLPBio | 250mg | 1116.58 Pln | |
| GLPBio | 5g | 5071.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,5-dibromo-1,3-thiazole-4-carboxylic acid (CAS 943735-44-2) is a chemical compound with the molecular formula C4HBr2NO2S and a molecular weight of 286.93 g/mol. IUPAC name: 2,5-dibromo-1,3-thiazole-4-carboxylic acid. InChIKey: BJOOXANOAMTJPK-UHFFFAOYSA-N.
| Molecular formula | C4HBr2NO2S |
|---|---|
| Molecular weight | 286.93 g/mol |
| IUPAC name | 2,5-dibromo-1,3-thiazole-4-carboxylic acid |
| InChIKey | BJOOXANOAMTJPK-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)Br)Br)C(=O)O |
Computed by PubChem (NCBI)