cas: 4887-95-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-1H-benzimidazole, 98%, 98% (CAS 4887-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFY5-100mg |
| cas | 4887-95-0 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 1048.40 Pln | |
| Chemat | 10g | 1653.20 Pln | |
| Chemat | 25g | 3246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-1H-benzimidazole (CAS 4887-95-0) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2,6-dichloro-1H-benzimidazole. InChIKey: LLIARSREYVCQHL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2,6-dichloro-1H-benzimidazole |
| InChIKey | LLIARSREYVCQHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)Cl |
Computed by PubChem (NCBI)