CAS 5912-18-5 appears in our catalog under these names: 4,6-Dichloro-1h-pyrrolo[2,3-b]pyridine, 98%, 4,6–dichloro–1H–pyrrolo(2,3–b)pyridine, 4,6-Dichloro-1H-pyrrolo(2,3-b)pyridine, 4,6-Dichloro-1H-pyrrolo[2,3-b]pyridine 95%, 4,6-Dichloro-7-azaindole, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 250mg, 500mg, 1000mg.
4,6-dichloro-1H-pyrrolo[2,3-b]pyridine (CAS 5912-18-5) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4,6-dichloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: LKORXMRYXIGVNO-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | LKORXMRYXIGVNO-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)