CAS 1000342-87-9 appears in our catalog under these names: 2,5-Dichloro-1h-pyrrolo[3,2-b]pyridine, 95%, 2,5-Dichloro-1H-pyrrolo(3,2-b)pyridine, 97%, 2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE, 97%, 97%, 2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
2,5-dichloro-1H-pyrrolo[3,2-b]pyridine (CAS 1000342-87-9) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2,5-dichloro-1H-pyrrolo[3,2-b]pyridine. InChIKey: RPMAMXHJEHUNIA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2,5-dichloro-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | RPMAMXHJEHUNIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)