cas: 438190-90-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-1H-imidazo[4,5-b]pyridine 95% (CAS 438190-90-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104358-100mg |
| cas | 438190-90-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1716.50 Pln | |
| Ambeed | 5g | 4998.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A104358 |
2,5-dichloro-1H-imidazo[4,5-b]pyridine (CAS 438190-90-0) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,5-dichloro-1H-imidazo[4,5-b]pyridine. InChIKey: CKQVHGHQFAOFNJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,5-dichloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | CKQVHGHQFAOFNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)