CAS 189102-97-4 appears in our catalog under these names: 5,6-dichloro-3H-iMidazo[4,5-b]pyridine, 97%, 97%, 5,6-Dichloro-3h-imidazo[4,5-b]pyridine, 95%, 5,6-dichloro-3H-imidazo(4,5-b)pyridine, 5,6-dichloro-1H-imidazo[4,5-b]pyridine, 97%. Offered by: Chemat, Combi-blocks, Biosynth, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 0,5g, 50mg.
5,6-dichloro-1H-imidazo[4,5-b]pyridine (CAS 189102-97-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,6-dichloro-1H-imidazo[4,5-b]pyridine. InChIKey: UWYSZYFNTMSWDF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,6-dichloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | UWYSZYFNTMSWDF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)N=CN2 |
Computed by PubChem (NCBI)