Products 888720-61-4
CAS 888720-61-4 appears in our catalog under these names: 4,5-Dichloropyrrolo[2,1-f][1,2,4]triazine, 95%, 4,5-Dichloropyrrolo(2,1-f)(1,2,4)triazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
4,5-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 888720-61-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4,5-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: QUFRWQJHIBMRGA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4,5-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | QUFRWQJHIBMRGA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)