cas: 280582-13-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-N-(4-fluorophenyl)pyrimidin-4-amine 95% (CAS 280582-13-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1107135-1g |
| cas | 280582-13-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 6350.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1107135 |
2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine (CAS 280582-13-0) is a chemical compound with the molecular formula C10H6Cl2FN3 and a molecular weight of 258.08 g/mol. IUPAC name: 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine. InChIKey: XBRSOMKUVTXYSJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FN3 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine |
| InChIKey | XBRSOMKUVTXYSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC=C2Cl)Cl)F |
Computed by PubChem (NCBI)