cas: 280582-13-0 — see every product listed under this CAS number, including other names
2,5-Dichloro-N-(4-fluorophenyl)pyrimidin-4-amine, 97%, 97% (CAS 280582-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BIDI-100mg |
| cas | 280582-13-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1427.60 Pln | |
| Chemat | 5g | 4485.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine (CAS 280582-13-0) is a chemical compound with the molecular formula C10H6Cl2FN3 and a molecular weight of 258.08 g/mol. IUPAC name: 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine. InChIKey: XBRSOMKUVTXYSJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FN3 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | 2,5-dichloro-N-(4-fluorophenyl)pyrimidin-4-amine |
| InChIKey | XBRSOMKUVTXYSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC=C2Cl)Cl)F |
Computed by PubChem (NCBI)