cas: 1427004-19-0 — see every product listed under this CAS number, including other names
2,5-Dioxo-1-pyrrolidinyl 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-17,20-dioxo-4,7,10,13-tetraoxa-16-azaeicosanoate, 98% (CAS 1427004-19-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862539-5MG |
| cas | 1427004-19-0 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 325.94 Pln | |
| Fluorochem | 10mg | 497.76 Pln | |
| Fluorochem | 25mg | 851.80 Pln | |
| Fluorochem | 50mg | 950.72 Pln | |
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2611.60 Pln | |
| Fluorochem | 1g | 6766.39 Pln | |
| Fluorochem | 5g | 20063.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1427004-19-0) is a chemical compound with the molecular formula C34H39N3O10 and a molecular weight of 649.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: RRCXYKNJTKJNTD-UHFFFAOYSA-N.
| Molecular formula | C34H39N3O10 |
|---|---|
| Molecular weight | 649.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | RRCXYKNJTKJNTD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)