DBCO-PEG4-NHS Ester, 97%, 97%
cas: 1427004-19-0 — see every product listed under this CAS number, including other names
DBCO-PEG4-NHS Ester, 97%, 97% (CAS 1427004-19-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 25mg, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ANK-50mg |
| cas | 1427004-19-0 |
| size | 50mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| Chemat | 25mg | 462.80 Pln | |
| Chemat | 10g | 7437.20 Pln | |
| Chemat | 25g | 14819.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1427004-19-0) is a chemical compound with the molecular formula C34H39N3O10 and a molecular weight of 649.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: RRCXYKNJTKJNTD-UHFFFAOYSA-N.
| Molecular formula | C34H39N3O10 |
|---|---|
| Molecular weight | 649.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | RRCXYKNJTKJNTD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)