DBCO-PEG4-NHS ester 95%
cas: 1427004-19-0 — see every product listed under this CAS number, including other names
DBCO-PEG4-NHS ester 95% (CAS 1427004-19-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A420011-50mg |
| cas | 1427004-19-0 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 960.00 Pln | |
| Ambeed | 100mg | 1577.44 Pln | |
| Ambeed | 250mg | 2634.31 Pln | |
| Ambeed | 1g | 6989.75 Pln | |
| Ambeed | 5g | 28989.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A420011 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1427004-19-0) is a chemical compound with the molecular formula C34H39N3O10 and a molecular weight of 649.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: RRCXYKNJTKJNTD-UHFFFAOYSA-N.
| Molecular formula | C34H39N3O10 |
|---|---|
| Molecular weight | 649.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | RRCXYKNJTKJNTD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)