cas: 76931-93-6 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 2-(acetylthio)acetate, 98%, 98% (CAS 76931-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G1I-100mg |
| cas | 76931-93-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 2584.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate (CAS 76931-93-6) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate. InChIKey: FLCQLSRLQIPNLM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate |
| InChIKey | FLCQLSRLQIPNLM-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)