cas: 76931-93-6 — see every product listed under this CAS number, including other names
N-Succinimidyl S-Acetylthioglycolate [Cross-linking Reagent], >94.0%(GC) (CAS 76931-93-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | S0431-1G |
| cas | 76931-93-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 1175.55 Pln | |
| TCI | 5g | 4037.39 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >94.0%(GC) |
(2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate (CAS 76931-93-6) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate. InChIKey: FLCQLSRLQIPNLM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate |
| InChIKey | FLCQLSRLQIPNLM-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)