cas: 76931-93-6 — see every product listed under this CAS number, including other names
N-Succinimidyl-S-acetylthioacetate 98% (CAS 76931-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A508892-100mg |
| cas | 76931-93-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 3107.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A508892 |
(2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate (CAS 76931-93-6) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate. InChIKey: FLCQLSRLQIPNLM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate |
| InChIKey | FLCQLSRLQIPNLM-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)