cas: 955094-26-5 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(2-(2-(3-(2,5-dioxo-2h-pyrrol-1(5h)-yl)propanamido)ethoxy)ethoxy)propanoate, 98%, 98% (CAS 955094-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJ76-100mg |
| cas | 955094-26-5 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 50g | 5958.80 Pln | |
| Chemat | 100g | 11128.40 Pln | |
| Chemat | 250g | 22206.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (CAS 955094-26-5) is a chemical compound with the molecular formula C18H23N3O9 and a molecular weight of 425.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate. InChIKey: TZPDZOJURBVWHS-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O9 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| InChIKey | TZPDZOJURBVWHS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)