Mal-amido-PEG2-NHS ester 95%
cas: 955094-26-5 — see every product listed under this CAS number, including other names
Mal-amido-PEG2-NHS ester 95% (CAS 955094-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100037-100mg |
| cas | 955094-26-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1532.94 Pln | |
| Ambeed | 10g | 2406.25 Pln | |
| Ambeed | 25g | 5510.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100037 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (CAS 955094-26-5) is a chemical compound with the molecular formula C18H23N3O9 and a molecular weight of 425.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate. InChIKey: TZPDZOJURBVWHS-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O9 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| InChIKey | TZPDZOJURBVWHS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)