cas: 76884-56-5 — see every product listed under this CAS number, including other names
2,6,7,8-Tetrahydro-2-oxopyrrolo[1,2-a]pyrimidine-3-carboxylic acid, ≥95%, ≥95% (CAS 76884-56-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SM6S-1g |
| cas | 76884-56-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 880.40 Pln | |
| Chemat | 5g | 2373.20 Pln | |
| Chemat | 10g | 4216.40 Pln | |
| Chemat | 25g | 7989.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid (CAS 76884-56-5) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid. InChIKey: AVLHVNKKTRBNFT-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid |
| InChIKey | AVLHVNKKTRBNFT-UHFFFAOYSA-N |
| SMILES | C1CC2=NC(=O)C(=CN2C1)C(=O)O |
Computed by PubChem (NCBI)