CAS 122-28-1 appears in our catalog under these names: 3'-Nitroacetanilide, 98%, m-Nitroacetanilide, 3'–Nitroacetanilide, 3'-Nitroacetanilide, 98+% , 3'-Nitroacetanilide, >98.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 2,5g, 50g, 250g.
N-(3-nitrophenyl)acetamide (CAS 122-28-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(3-nitrophenyl)acetamide. InChIKey: KFTYNYHJHKCRKU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(3-nitrophenyl)acetamide |
| InChIKey | KFTYNYHJHKCRKU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)