CAS 28226-22-4 appears in our catalog under these names: 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine, 98%, 6-Nitro-3,4-dihydro-2H-benzo(b)(1,4)oxazine, 98%, 6-Nitro-3,4-dihydro-2H-1,4-benzoxazine, 97% , 6-Nitro-3,4-dihydro-2H-benzo(b)(1,4)oxazine, 6-Nitro-3,4-dihydro-2H-benzo[b][1,4]oxazine, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 2,5g.
6-nitro-3,4-dihydro-2H-1,4-benzoxazine (CAS 28226-22-4) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 6-nitro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: GZAJZBARYACGSO-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | GZAJZBARYACGSO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)