cas: 16727-46-1 — see every product listed under this CAS number, including other names
2,6-Bis(benzyloxy)pyridine, 98%, 98% (CAS 16727-46-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112X02-1g |
| cas | 16727-46-1 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 256.40 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 250g | 904.40 Pln | |
| Chemat | 500g | 1785.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-bis(phenylmethoxy)pyridine (CAS 16727-46-1) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2,6-bis(phenylmethoxy)pyridine. InChIKey: IREZYNKPQCIUME-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2,6-bis(phenylmethoxy)pyridine |
| InChIKey | IREZYNKPQCIUME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)