cas: 35852-57-4 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-(trifluoromethyl)phenol, 97%, 97% (CAS 35852-57-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I84Q-10g |
| cas | 35852-57-4 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2762.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1677.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dibromo-4-(trifluoromethyl)phenol (CAS 35852-57-4) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 2,6-dibromo-4-(trifluoromethyl)phenol. InChIKey: IEMNQLAXBXXIKT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 2,6-dibromo-4-(trifluoromethyl)phenol |
| InChIKey | IEMNQLAXBXXIKT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)