cas: 10546-66-4 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-butylaniline, ≥98%, ≥98% (CAS 10546-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195SC-100mg |
| cas | 10546-66-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 693.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2,6-dibromo-4-butylaniline (CAS 10546-66-4) is a chemical compound with the molecular formula C10H13Br2N and a molecular weight of 307.02 g/mol. IUPAC name: 2,6-dibromo-4-butylaniline. InChIKey: HVEXPCBRDISAGF-UHFFFAOYSA-N.
| Molecular formula | C10H13Br2N |
|---|---|
| Molecular weight | 307.02 g/mol |
| IUPAC name | 2,6-dibromo-4-butylaniline |
| InChIKey | HVEXPCBRDISAGF-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)