cas: 10546-65-3 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-isopropylaniline (CAS 10546-65-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023322-25G |
| cas | 10546-65-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 794.53 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dibromo-4-propan-2-ylaniline (CAS 10546-65-3) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,6-dibromo-4-propan-2-ylaniline. InChIKey: CJEBZUFROMNDEK-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,6-dibromo-4-propan-2-ylaniline |
| InChIKey | CJEBZUFROMNDEK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)