CAS 81090-45-1 appears in our catalog under these names: 2,4-Dibromo-6-isopropylaniline, 95%, 2,4-Dibromo-6-isopropylaniline, 95+%, 95+%, 2,4-Dibromo-6-isopropylaniline, 85%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 100mg, 250mg.
2,4-dibromo-6-propan-2-ylaniline (CAS 81090-45-1) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,4-dibromo-6-propan-2-ylaniline. InChIKey: OKIHDLUSXGDARZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,4-dibromo-6-propan-2-ylaniline |
| InChIKey | OKIHDLUSXGDARZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)Br)N |
Computed by PubChem (NCBI)