CAS 321352-52-7 appears in our catalog under these names: 5-Bromo-2,3-dihydro-1h-inden-2-amine hydrobromide, 98%, 5-Bromo-2,3-dihydro-1H-inden-2-amine hydrobromide, 5-Bromoindan-2-ylamine hydrobromide, 98%, 98%, 5-Bromo-2,3-dihydro-1H-inden-2-amine hydrobromide, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 1000mg, 2000mg, 5000mg, 500g, 250mg.
5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide (CAS 321352-52-7) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide. InChIKey: WVNGAALXGMXZJI-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide |
| InChIKey | WVNGAALXGMXZJI-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)Br)N.Br |
Computed by PubChem (NCBI)