cas: 2432-16-8 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-isopropylphenol (CAS 2432-16-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631961-5G |
| cas | 2432-16-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 2996.88 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dibromo-4-propan-2-ylphenol (CAS 2432-16-8) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 2,6-dibromo-4-propan-2-ylphenol. InChIKey: DOSJZFDHMKBPRM-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 2,6-dibromo-4-propan-2-ylphenol |
| InChIKey | DOSJZFDHMKBPRM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)