Products 2432-16-8
CAS 2432-16-8 appears in our catalog under these names: 2,6-Dibromo-4-isopropylphenol, 97%, 2,6-Dibromo-4-isopropylphenol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2,6-dibromo-4-propan-2-ylphenol (CAS 2432-16-8) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 2,6-dibromo-4-propan-2-ylphenol. InChIKey: DOSJZFDHMKBPRM-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 2,6-dibromo-4-propan-2-ylphenol |
| InChIKey | DOSJZFDHMKBPRM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)