CAS 96089-14-4 is the registry number for 3,4-Dibromo-2,5,6-trimethylphenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dibromo-2,5,6-trimethylphenol (CAS 96089-14-4) is a chemical compound with the molecular formula C9H10Br2O and a molecular weight of 293.98 g/mol. IUPAC name: 3,4-dibromo-2,5,6-trimethylphenol. InChIKey: QIHIFMDVYGTLPN-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2O |
|---|---|
| Molecular weight | 293.98 g/mol |
| IUPAC name | 3,4-dibromo-2,5,6-trimethylphenol |
| InChIKey | QIHIFMDVYGTLPN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1O)C)Br)Br)C |
Computed by PubChem (NCBI)