cas: 10546-64-2 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-n-propylaniline, ≥98%, ≥98% (CAS 10546-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G3D-1g |
| cas | 10546-64-2 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 218.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2,6-dibromo-4-propylaniline (CAS 10546-64-2) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,6-dibromo-4-propylaniline. InChIKey: DTMCGFMOLUVBPL-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,6-dibromo-4-propylaniline |
| InChIKey | DTMCGFMOLUVBPL-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=C(C(=C1)Br)N)Br |
Computed by PubChem (NCBI)