cas: 1451392-98-5 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-formylphenylboronic acid (CAS 1451392-98-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627980-1G |
| cas | 1451392-98-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2549.12 Pln | |
| Fluorochem | 5g | 7510.91 Pln |
| delivery time | 3-4 weeks |
|---|
(2,6-dichloro-4-formylphenyl)boronic acid (CAS 1451392-98-5) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (2,6-dichloro-4-formylphenyl)boronic acid. InChIKey: JIIZYKDHZYFDOO-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O3 |
|---|---|
| Molecular weight | 218.83 g/mol |
| IUPAC name | (2,6-dichloro-4-formylphenyl)boronic acid |
| InChIKey | JIIZYKDHZYFDOO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)C=O)Cl)(O)O |
Computed by PubChem (NCBI)