cas: 90213-66-4 — see every product listed under this CAS number, including other names
2,6-Dichloro-7-deazapurine 97% (CAS 90213-66-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181078-250mg |
| cas | 90213-66-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 459.38 Pln | |
| Ambeed | 500g | 1983.50 Pln | |
| Ambeed | 1000g | 3685.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181078 |
2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine (CAS 90213-66-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: GHXBPCSSQOKKGB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | GHXBPCSSQOKKGB-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)