cas: 190655-14-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-9-ethyl-9H-purine 97% (CAS 190655-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A916888-100mg |
| cas | 190655-14-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2361.75 Pln | |
| Ambeed | 5g | 6539.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A916888 |
2,6-dichloro-9-ethylpurine (CAS 190655-14-2) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-9-ethylpurine. InChIKey: PRESUDAFHFFHLT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-9-ethylpurine |
| InChIKey | PRESUDAFHFFHLT-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)