CAS 1072895-86-3 is the registry number for 4,6-Dichloro-1,3-dimethyl-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
4,6-dichloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine (CAS 1072895-86-3) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 4,6-dichloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine. InChIKey: VBDCTFDIXXYZOO-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 4,6-dichloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine |
| InChIKey | VBDCTFDIXXYZOO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)