2,6-Dichloro-9-ethyl-9H-purine, 97%
cas: 190655-14-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-9-ethyl-9H-purine, 97% (CAS 190655-14-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A916888-250mg |
| cas | 190655-14-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2389.56 Pln | |
| Ambeed | 5g | 6605.94 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1749.20 Pln | |
| Chemat | 5g | 6640.40 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2569.12 Pln | |
| BLDpharm | 5g | 7117.52 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 2392.93 Pln | |
| Fluorochem | 100mg | 523.79 Pln | |
| Fluorochem | 5g | 6443.58 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,6-dichloro-9-ethylpurine (CAS 190655-14-2) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-9-ethylpurine. InChIKey: PRESUDAFHFFHLT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-9-ethylpurine |
| InChIKey | PRESUDAFHFFHLT-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)