cas: 190655-14-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-9-ethyl-9H-purine, 97% (CAS 190655-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607804-100MG |
| cas | 190655-14-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1627.57 Pln | |
| Fluorochem | 1g | 4407.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloro-9-ethylpurine (CAS 190655-14-2) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-9-ethylpurine. InChIKey: PRESUDAFHFFHLT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-9-ethylpurine |
| InChIKey | PRESUDAFHFFHLT-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)