cas: 112581-77-8 — see every product listed under this CAS number, including other names
2,6-Dichloroimidazo[1,2-b]pyridazine, 95%, 95% (CAS 112581-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11937I-100mg |
| cas | 112581-77-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 707.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloroimidazo[1,2-b]pyridazine (CAS 112581-77-8) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 2,6-dichloroimidazo[1,2-b]pyridazine. InChIKey: MGNCSIAIZSTMHX-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,6-dichloroimidazo[1,2-b]pyridazine |
| InChIKey | MGNCSIAIZSTMHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)