cas: 73568-41-9 — see every product listed under this CAS number, including other names
2,6-Dichloroquinoline-3-carbaldehyde, 98%, 98% (CAS 73568-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119QN0-100mg |
| cas | 73568-41-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1086.80 Pln | |
| Chemat | 5g | 3146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloroquinoline-3-carbaldehyde (CAS 73568-41-9) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 2,6-dichloroquinoline-3-carbaldehyde. InChIKey: WZUNMOMEOMPYKZ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,6-dichloroquinoline-3-carbaldehyde |
| InChIKey | WZUNMOMEOMPYKZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)